Difference between revisions of "Tiso gene 805"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * smiles: ** C(C1(C=CC(=CC=1)O))(=O)[O-] * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_805 == * right end position: ** 11982 * transcription direction: ** POSITIVE * left end position: ** 9948 * centisome position: ** 34.73585...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_805 == |
− | * | + | * right end position: |
− | ** | + | ** 11982 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 9948 |
− | * | + | * centisome position: |
− | ** | + | ** 34.73585 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ADENYL-KIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | ** Source: [[orthology-athaliana]] | |
− | == | + | ** Source: [[orthology-synechocystis]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[ATAM]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[ATDAM]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[DEOXYADENYLATE-KINASE-RXN]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
+ | * [[PWY-7224]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=11982}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=9948}} | |
− | + | {{#set: centisome position=34.73585 }} | |
− | + | {{#set: reaction associated=ADENYL-KIN-RXN|ATAM|ATDAM|DEOXYADENYLATE-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219|PWY-7224}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:29, 21 March 2018
Gene Tiso_gene_805
- right end position:
- 11982
- transcription direction:
- POSITIVE
- left end position:
- 9948
- centisome position:
- 34.73585
- Synonym(s):
Reactions associated
- Reaction: ADENYL-KIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: ATAM
- Source: orthology-creinhardtii
- Reaction: ATDAM
- Source: orthology-creinhardtii
- Reaction: DEOXYADENYLATE-KINASE-RXN
- Source: orthology-synechocystis