Difference between revisions of "CPD-7006"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5289 RXN0-5289] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5289 RXN0-5289] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1]
+
** tetrahydrogeranylgeranyl chlorophyll a
 +
* inchi key:
 +
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
 +
* molecular weight:
 +
** 890.479   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetrahydroGG-chlorophyll a
 +
** tetrahydroGG-chl a
 +
** tetrahydrogeranylgeranyl-chl a
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7666]]
** 1 [[GLYCERATE]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[TARTRONATE-S-ALD]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-7665]]
** 1 D-glycerate[c] '''+''' 1 NAD+[c] '''<=>''' 1 NADH[c] '''+''' 1 tartronate semialdehyde[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Tiso_gene_777]]
+
** Source: [[orthology-creinhardtii]]
+
* Gene: [[Tiso_gene_91]]
+
** Source: [[orthology-creinhardtii]]
+
== Pathways  ==
+
* [[GLYCOLATEMET-PWY]], glycolate and glyoxylate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATEMET-PWY GLYCOLATEMET-PWY]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-creinhardtii]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R01745 R01745]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
{{#set: direction=REVERSIBLE}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
{{#set: ec number=EC-1.1.1}}
+
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
{{#set: gene associated=Tiso_gene_777|Tiso_gene_91}}
+
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
{{#set: in pathway=GLYCOLATEMET-PWY}}
+
{{#set: molecular weight=890.479    }}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
{{#set: reconstruction source=orthology-creinhardtii}}
+
{{#set: consumed by=RXN-7666}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-7665}}

Latest revision as of 20:29, 21 March 2018

Metabolite CPD-7006

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • tetrahydrogeranylgeranyl chlorophyll a
  • inchi key:
    • InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
  • molecular weight:
    • 890.479
  • Synonym(s):
    • tetrahydroGG-chlorophyll a
    • tetrahydroGG-chl a
    • tetrahydrogeranylgeranyl-chl a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.