Difference between revisions of "CYSTEINE-DEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CYSTEINE-DEG-PWY CYSTEINE-DEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CYSTEINE-DEG-PWY CYSTEINE-DEG-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-cysteine degradation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cysteine degradation I |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
| − | * | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_17718]] |
| − | + | ** 2 reconstruction source(s) associated: | |
| − | * [[ | + | *** [[orthology-athaliana]] |
| − | * | + | *** [[orthology-esiliculosus]] |
| − | * [[ | + | * [[CYSTEINE-DIOXYGENASE-RXN]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_1457]] |
| − | * [[ | + | ** 3 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-in-silico_annotation]] |
| − | * [[ | + | *** [[orthology-creinhardtii]] |
| − | == Reaction(s) | + | *** [[orthology-esiliculosus]] |
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE-SPON-RXN 3-SULFINYL-PYRUVATE-SPON-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-40674}} | |
| − | + | {{#set: common name=L-cysteine degradation I}} | |
| − | + | {{#set: common name=cysteine degradation I}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:29, 21 March 2018
Pathway CYSTEINE-DEG-PWY
- taxonomic range:
- common name:
- L-cysteine degradation I
- Synonym(s):
- cysteine degradation I
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- 3-SULFINOALANINE-AMINOTRANSFERASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- CYSTEINE-DIOXYGENASE-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
