Difference between revisions of "PWY-7049"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7049 PWY-7049] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7049 PWY-7049] ==
* smiles:
+
* taxonomic range:
** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N
+
 
* common name:
 
* common name:
** lanosterol
+
** icosapentaenoate biosynthesis II (6-desaturase, mammals)
* molecular weight:
+
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol
+
** eicosapentaenoic acid biosynthesis II
 +
** eicosapentaenoate biosynthesis II (metazoa)
 +
** iicosapentaenoic acid biosynthesis II
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN3O-130]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
* [[RXN66-303]]
+
* [[LINOLENOYL-RXN]]
== Reaction(s) known to produce the compound ==
+
** 9 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_4191]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_348]]
 +
*** [[Tiso_gene_7855]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_9394]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-16020]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_9871]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13426 RXN-13426]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13429 RXN-13429]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16019 RXN-16019]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16021 RXN-16021]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16022 RXN-16022]
 
== External links  ==
 
== External links  ==
* CAS : 79-63-0
+
{{#set: taxonomic range=TAX-33208}}
* DRUGBANK : DB03696
+
{{#set: taxonomic range=TAX-4751}}
* PUBCHEM:
+
{{#set: common name=icosapentaenoate biosynthesis II (6-desaturase, mammals)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=246983 246983]
+
{{#set: common name=eicosapentaenoic acid biosynthesis II|eicosapentaenoate biosynthesis II (metazoa)|iicosapentaenoic acid biosynthesis II}}
* HMDB : HMDB01251
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=7}}
** [http://www.genome.jp/dbget-bin/www_bget?C01724 C01724]
+
{{#set: completion rate=29.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16521 16521]
+
* METABOLIGHTS : MTBLC16521
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: inchi key=InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N}}
+
{{#set: common name=lanosterol}}
+
{{#set: molecular weight=426.724    }}
+
{{#set: common name=4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN3O-130|RXN66-303}}
+

Latest revision as of 19:30, 21 March 2018

Pathway PWY-7049

  • taxonomic range:
  • common name:
    • icosapentaenoate biosynthesis II (6-desaturase, mammals)
  • Synonym(s):
    • eicosapentaenoic acid biosynthesis II
    • eicosapentaenoate biosynthesis II (metazoa)
    • iicosapentaenoic acid biosynthesis II

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links