Difference between revisions of "Tiso gene 10532"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] == * smiles: ** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Gene == Gene Tiso_gene_10532 == * right end position: ** 7439 * transcription direction: ** POSITIVE * left end position: ** 6592 * centisome position: ** 77.9657...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] ==
+
== Gene Tiso_gene_10532 ==
* smiles:
+
* right end position:
** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 7439
* inchi key:
+
* transcription direction:
** InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J
+
** POSITIVE
* common name:
+
* left end position:
** 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA
+
** 6592
* molecular weight:
+
* centisome position:
** 1072.006    
+
** 77.9657    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CYCLOEUCALENOL-CYCLOISOMERASE-RXN]]
* [[RXN-14484]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-2541]]
 +
* [[PWY-7155]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=7439}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193763 72193763]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=6592}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76387 76387]
+
{{#set: centisome position=77.9657    }}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=CYCLOEUCALENOL-CYCLOISOMERASE-RXN}}
{{#set: inchi key=InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J}}
+
{{#set: pathway associated=PWY-2541|PWY-7155}}
{{#set: common name=3R-hydroxy-(11Z)-eicos-11-enoyl-CoA}}
+
{{#set: molecular weight=1072.006    }}
+
{{#set: produced by=RXN-14484}}
+

Latest revision as of 19:30, 21 March 2018

Gene Tiso_gene_10532

  • right end position:
    • 7439
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6592
  • centisome position:
    • 77.9657
  • Synonym(s):

Reactions associated

Pathways associated

External links