Difference between revisions of "Tiso gene 13477"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
(Created page with "Category:Gene == Gene Tiso_gene_13477 == * right end position: ** 4803 * transcription direction: ** NEGATIVE * left end position: ** 2772 * centisome position: ** 44.2387...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
+
== Gene Tiso_gene_13477 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 4803
−
* common name:
+
* transcription direction:
−
** tetrahydrogeranylgeranyl chlorophyll a
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
+
** 2772
−
* molecular weight:
+
* centisome position:
−
** 890.479    
+
** 44.23875    
 
* Synonym(s):
 
* Synonym(s):
−
** tetrahydroGG-chlorophyll a
 
−
** tetrahydroGG-chl a
 
−
** tetrahydrogeranylgeranyl-chl a
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7666]]
+
* Reaction: [[ADENYL-KIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN-7665]]
+
* Reaction: [[GLUC1PURIDYLTRANS-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[PGCM]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[PGMTh]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[PHOSMANMUT-RXN]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[PHOSPHOGLUCMUT-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14456]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-16997]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16998]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-3801]]
 +
* [[PWY-7817]]
 +
* [[PWY-5659]]
 +
* [[PWY-2723]]
 +
* [[GLYCOGENSYNTH-PWY]]
 +
* [[PWY-5384]]
 +
* [[PWY-7343]]
 +
* [[PWY-7456]]
 +
* [[PWY-6527]]
 +
* [[PWY-5661]]
 +
* [[PWY-622]]
 +
* [[PWY-6317]]
 +
* [[PWY66-422]]
 +
* [[PWY-5941]]
 +
* [[PWY-5940]]
 +
* [[PWY-7238]]
 +
* [[PWY-882]]
 +
* [[GLYCOCAT-PWY]]
 +
* [[PWY-7219]]
 +
* [[PWY-7586]]
 +
* [[PWY-6731]]
 +
* [[GLUCOSE1PMETAB-PWY]]
 +
* [[PWY-6737]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4803}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: left end position=2772}}
−
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: centisome position=44.23875   }}
−
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
+
{{#set: reaction associated=ADENYL-KIN-RXN|GLUC1PURIDYLTRANS-RXN|PGCM|PGMTh|PHOSMANMUT-RXN|PHOSPHOGLUCMUT-RXN|RXN-14456|RXN-16997|RXN-16998}}
−
{{#set: molecular weight=890.479   }}
+
{{#set: pathway associated=PWY-3801|PWY-7817|PWY-5659|PWY-2723|GLYCOGENSYNTH-PWY|PWY-5384|PWY-7343|PWY-7456|PWY-6527|PWY-5661|PWY-622|PWY-6317|PWY66-422|PWY-5941|PWY-5940|PWY-7238|PWY-882|GLYCOCAT-PWY|PWY-7219|PWY-7586|PWY-6731|GLUCOSE1PMETAB-PWY|PWY-6737}}
−
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
+
−
{{#set: consumed by=RXN-7666}}
+
−
{{#set: produced by=RXN-7665}}
+

Latest revision as of 19:30, 21 March 2018

Gene Tiso_gene_13477

  • right end position:
    • 4803
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 2772
  • centisome position:
    • 44.23875
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13477&oldid=41997"