Difference between revisions of "PWY0-901"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-901 PWY0-901] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-901 PWY0-901] ==
* smiles:
+
* taxonomic range:
** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J
+
 
* common name:
 
* common name:
** OPC6-3-ketoacyl-CoA
+
** L-selenocysteine biosynthesis I (bacteria)
* molecular weight:
+
** 1025.85   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-10700]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2.7.9.3-RXN]]
* [[RXN-10702]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_5669]]
 +
*** [[Tiso_gene_5668]]
 +
*** [[Tiso_gene_14608]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN0-2161]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_587]]
 +
*** [[Tiso_gene_10015]]
 +
*** [[Tiso_gene_1682]]
 +
*** [[Tiso_gene_1684]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.9.1.1-RXN 2.9.1.1-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237277 44237277]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-901 PWY0-901]
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
* LIGAND-MAP:
{{#set: inchi key=InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?map00970 map00970]
{{#set: common name=OPC6-3-ketoacyl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: molecular weight=1025.85    }}
+
{{#set: common name=L-selenocysteine biosynthesis I (bacteria)}}
{{#set: consumed by=RXN-10700}}
+
{{#set: reaction found=2}}
{{#set: produced by=RXN-10702}}
+
{{#set: total reaction=3}}
 +
{{#set: completion rate=67.0}}

Latest revision as of 19:30, 21 March 2018

Pathway PWY0-901

  • taxonomic range:
  • common name:
    • L-selenocysteine biosynthesis I (bacteria)
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links