Difference between revisions of "Tiso gene 1253"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] == * smiles: ** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Gene == Gene Tiso_gene_1253 == * right end position: ** 24176 * transcription direction: ** POSITIVE * left end position: ** 21867 * centisome position: ** 88.205...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] ==
+
== Gene Tiso_gene_1253 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 24176
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 6-cis, 3-oxo-tridecenoyl-CoA
+
** 21867
−
* molecular weight:
+
* centisome position:
−
** 971.802    
+
** 88.2054    
 
* Synonym(s):
 
* Synonym(s):
−
** 6Z, 3-oxo-tridecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14774]]
+
* Reaction: [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=24176}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657308 90657308]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=21867}}
−
{{#set: inchi key=InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J}}
+
{{#set: centisome position=88.2054   }}
−
{{#set: common name=6-cis, 3-oxo-tridecenoyl-CoA}}
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: molecular weight=971.802   }}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: common name=6Z, 3-oxo-tridecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14774}}
+

Latest revision as of 20:30, 21 March 2018

Gene Tiso_gene_1253

  • right end position:
    • 24176
  • transcription direction:
    • POSITIVE
  • left end position:
    • 21867
  • centisome position:
    • 88.2054
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1253&oldid=42050"