Difference between revisions of "CPD-16001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * inchi key: ** InC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16001 CPD-16001] == * smiles: ** CCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16001 CPD-16001] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (11Z)-hexadecenoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=LFNOUYUFXGXNNP-UBPKJMQESA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 999.899 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (Z)-hexadec-11-enyl-CoA |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-16557]] | |
| − | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657952 90657952] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86120 86120] |
| − | + | {{#set: smiles=CCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | {{#set: smiles= | + | {{#set: common name=(11Z)-hexadecenoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LFNOUYUFXGXNNP-UBPKJMQESA-J}} |
| − | {{#set: | + | {{#set: molecular weight=999.899 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=(Z)-hexadec-11-enyl-CoA}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-16557}} |
| − | {{#set: consumed | + | |
| − | + | ||
Latest revision as of 19:30, 21 March 2018
Contents
Metabolite CPD-16001
- smiles:
- CCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (11Z)-hexadecenoyl-CoA
- inchi key:
- InChIKey=LFNOUYUFXGXNNP-UBPKJMQESA-J
- molecular weight:
- 999.899
- Synonym(s):
- (Z)-hexadec-11-enyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
