Difference between revisions of "Tiso gene 10259"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * common name: ** f...") |
(Created page with "Category:Gene == Gene Tiso_gene_10259 == * Synonym(s): == Reactions associated == * Reaction: 2.1.1.113-RXN ** Source: orthology-esiliculosus == Pathways associat...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10259 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.1.1.113-RXN]] |
− | * | + | ** Source: [[orthology-esiliculosus]] |
− | + | == Pathways associated == | |
− | * [[ | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.1.1.113-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:30, 21 March 2018
Gene Tiso_gene_10259
- Synonym(s):
Reactions associated
- Reaction: 2.1.1.113-RXN
- Source: orthology-esiliculosus