Difference between revisions of "HOMOCYSDEGR-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** phytenal
+
** L-cysteine biosynthesis III (from L-homocysteine)
−
* molecular weight:
+
−
** 294.52   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2E-phytenal
+
** L-homocysteine degradation
−
** 3,7,11,15-tetramethyl-2E-hexadecenal
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-479]]
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
−
* [[RXN66-478]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_7852]]
 +
*** [[Tiso_gene_3732]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-14048]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3732]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-15121]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-15123]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104010025
+
* LIGAND-MAP:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?map00660 map00660]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764]
+
{{#set: taxonomic range=TAX-33154}}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}}
+
{{#set: taxonomic range=TAX-2157}}
−
{{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=phytenal}}
+
{{#set: common name=L-cysteine biosynthesis III (from L-homocysteine)}}
−
{{#set: molecular weight=294.52    }}
+
{{#set: common name=L-homocysteine degradation}}
−
{{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}}
+
{{#set: reaction found=4}}
−
{{#set: consumed by=RXN66-479}}
+
{{#set: total reaction=4}}
−
{{#set: produced by=RXN66-478}}
+
{{#set: completion rate=100.0}}

Latest revision as of 19:31, 21 March 2018

Pathway HOMOCYSDEGR-PWY

  • taxonomic range:
  • common name:
    • L-cysteine biosynthesis III (from L-homocysteine)
  • Synonym(s):
    • L-homocysteine degradation

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HOMOCYSDEGR-PWY&oldid=42095"