Difference between revisions of "CPD-19395"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200918 TAX-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * common name:...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200918 TAX-200918]
+
** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
+
 
* common name:
 
* common name:
** L-ornithine degradation II (Stickland reaction)
+
** γ-L-glutamyl-glycylglycine
 +
* inchi key:
 +
** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
 +
* molecular weight:
 +
** 260.226   
 
* Synonym(s):
 
* Synonym(s):
 +
** γ-L-Glu-Gly-Gly
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''4''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[SPONTPRO-RXN]]
+
* [[RXN-18092]]
** [[PROLINE-RACEMASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
+
** [[PYRROLINECARBREDUCT-RXN]]
+
== Reaction(s) not found ==
+
* '''5''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=AKPTHIOL-RXN AKPTHIOL-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=PRDABST-RXN PRDABST-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=24-DIAMINOPENTANOATE-DEHYDROGENASE-RXN 24-DIAMINOPENTANOATE-DEHYDROGENASE-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=ORNMUTST-RXN ORNMUTST-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE-RACEMASE-RXN ORNITHINE-RACEMASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-200918}}
+
{{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}}
{{#set: taxonomic range=TAX-201174}}
+
{{#set: common name=γ-L-glutamyl-glycylglycine}}
{{#set: taxonomic range=TAX-1239}}
+
{{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}}
{{#set: common name=L-ornithine degradation II (Stickland reaction)}}
+
{{#set: molecular weight=260.226    }}
{{#set: reaction found=4}}
+
{{#set: common name=γ-L-Glu-Gly-Gly}}
{{#set: reaction not found=5}}
+
{{#set: produced by=RXN-18092}}

Latest revision as of 19:31, 21 March 2018

Metabolite CPD-19395

  • smiles:
    • C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
  • common name:
    • γ-L-glutamyl-glycylglycine
  • inchi key:
    • InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
  • molecular weight:
    • 260.226
  • Synonym(s):
    • γ-L-Glu-Gly-Gly

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O" cannot be used as a page name in this wiki.