Difference between revisions of "Tiso gene 13686"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_13686 == * Synonym(s): == Reactions associated == * Reaction: RIBOFLAVIN-SYN-RXN ** Source: orthology-athaliana ** Source: ortho...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_13686 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[RIBOFLAVIN-SYN-RXN]] | |
| − | * [[ | + | ** Source: [[orthology-athaliana]] |
| − | == | + | ** Source: [[orthology-synechocystis]] |
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-6167]] | ||
| + | * [[PWY-6168]] | ||
| + | * [[RIBOSYN2-PWY]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: reaction associated=RIBOFLAVIN-SYN-RXN}} |
| − | {{#set: | + | {{#set: pathway associated=PWY-6167|PWY-6168|RIBOSYN2-PWY}} |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:31, 21 March 2018
Gene Tiso_gene_13686
- Synonym(s):
Reactions associated
- Reaction: RIBOFLAVIN-SYN-RXN
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
