Difference between revisions of "PWY-6269"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2107 CPD0-2107] == * smiles: ** CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2107 CPD0-2107] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=IJFLXRCJWPKGKJ-LXIXEQKWSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxydodecanoyl-CoA
+
** adenosylcobalamin salvage from cobinamide II
* molecular weight:
+
** 961.807   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** vitamin B12 biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[BTUR2-RXN]]
* [[HACD5m]]
+
** 1 associated gene(s):
* [[HACD5]]
+
*** [[Tiso_gene_6190]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-8770]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_16271]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R346-RXN R346-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6261 RXN-6261]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2157}}
** [http://www.genome.jp/dbget-bin/www_bget?C05262 C05262]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=adenosylcobalamin salvage from cobinamide II}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62558 62558]
+
{{#set: common name=vitamin B12 biosynthesis}}
* BIGG : 3hddcoa
+
{{#set: reaction found=2}}
* PUBCHEM:
+
{{#set: total reaction=7}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173081 46173081]
+
{{#set: completion rate=29.0}}
* HMDB : HMDB03936
+
{{#set: smiles=CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
{{#set: inchi key=InChIKey=IJFLXRCJWPKGKJ-LXIXEQKWSA-J}}
+
{{#set: common name=(S)-3-hydroxydodecanoyl-CoA}}
+
{{#set: molecular weight=961.807    }}
+
{{#set: consumed or produced by=HACD5m|HACD5}}
+

Latest revision as of 19:31, 21 March 2018

Pathway PWY-6269

  • taxonomic range:
  • common name:
    • adenosylcobalamin salvage from cobinamide II
  • Synonym(s):
    • vitamin B12 biosynthesis

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links