Difference between revisions of "PWY-6269"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** adenosylcobalamin salvage from cobinamide II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | + | ** vitamin B12 biosynthesis | |
| − | + | ||
| − | ** vitamin | + | |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN | + | '''2''' reactions found over '''7''' reactions in the full pathway |
| − | * | + | * [[BTUR2-RXN]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_6190]] |
| − | * [[RXN- | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[orthology-esiliculosus]] |
| − | * [[ | + | * [[RXN-8770]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| − | * [ | + | *** [[Tiso_gene_16271]] |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| − | * [ | + | *** [[annotation-in-silico_annotation]] |
| − | * [ | + | == Reaction(s) not found == |
| − | + | * [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN] | |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN] |
| + | * [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=R346-RXN R346-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6261 RXN-6261] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=adenosylcobalamin salvage from cobinamide II}} | |
| − | + | {{#set: common name=vitamin B12 biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=29.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:31, 21 March 2018
Pathway PWY-6269
- taxonomic range:
- common name:
- adenosylcobalamin salvage from cobinamide II
- Synonym(s):
- vitamin B12 biosynthesis
Reaction(s) found
2 reactions found over 7 reactions in the full pathway
- BTUR2-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-8770
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
