Difference between revisions of "Tiso gene 3021"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3021 == * Synonym(s): == Reactions associated == * Reaction: 1.14.11.2-RXN ** Source: orthology-esiliculosus * Reaction: RXN490-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
+
== Gene Tiso_gene_3021 ==
−
* smiles:
+
−
** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
+
−
* inchi key:
+
−
** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
+
−
* common name:
+
−
** 5-enolpyruvoyl-shikimate 3-phosphate
+
−
* molecular weight:
+
−
** 320.149   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-enolpyruvyl-shikimate 5-phosphate
 
−
** 3-enolpyruvyl-shikimate-5-P
 
−
** 5-O-(1-carboxyvinyl)-3-phosphoshikimate
 
−
** 5-enolpyruvyl-shikimate 3-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[CHORISMATE-SYNTHASE-RXN]]
+
* Reaction: [[1.14.11.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN490-3641]]
−
* [[2.5.1.19-RXN]]
+
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701]
+
−
* BIGG : 3psme
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269]
+
−
{{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}}
+
−
{{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}}
+
−
{{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}}
+
−
{{#set: molecular weight=320.149    }}
+
−
{{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}}
+
−
{{#set: consumed by=CHORISMATE-SYNTHASE-RXN}}
+
−
{{#set: consumed or produced by=2.5.1.19-RXN}}
+

Latest revision as of 19:31, 21 March 2018

Gene Tiso_gene_3021

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3021&oldid=42156"