Difference between revisions of "CPD-19169"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3385 == * Synonym(s): == Reactions associated == * RXN-1224 ** pantograph-esiliculosus * RXN-15117 ** pantograph-ath...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == |
| + | * smiles: | ||
| + | ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * common name: | ||
| + | ** 3-oxo-(9Z)-octadecenoyl-CoA | ||
| + | * inchi key: | ||
| + | ** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J | ||
| + | * molecular weight: | ||
| + | ** 1041.936 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-18:1-Δ9-CoA | ||
| + | ** 3-oxo-9-cis-octadecenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-17778]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | * [[RXN-17777]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}} |
| + | {{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}} | ||
| + | {{#set: molecular weight=1041.936 }} | ||
| + | {{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-17778}} | ||
| + | {{#set: produced by=RXN-17777}} | ||
Latest revision as of 20:31, 21 March 2018
Contents
Metabolite CPD-19169
- smiles:
- CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxo-(9Z)-octadecenoyl-CoA
- inchi key:
- InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
- molecular weight:
- 1041.936
- Synonym(s):
- 3-oxo-18:1-Δ9-CoA
- 3-oxo-9-cis-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
