Difference between revisions of "PWY-5443"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5443 PWY-5443] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5443 PWY-5443] ==
* smiles:
+
* taxonomic range:
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** 24-methylenecholesterol
+
** aminopropanol phosphate biosynthesis I
* inchi key:
+
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
+
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 1-amino-propan-2-yl phosphate biosynthesis from threonine
 +
** (R)-1-amino-2-propanol O-2-phosphate biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN-707]]
+
* [[RXN-8626]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_8616]]
 +
*** [[Tiso_gene_16943]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=4.1.1.81-RXN 4.1.1.81-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92113 92113]
+
{{#set: common name=aminopropanol phosphate biosynthesis I}}
* HMDB : HMDB06849
+
{{#set: common name=1-amino-propan-2-yl phosphate biosynthesis from threonine|(R)-1-amino-2-propanol O-2-phosphate biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
+
{{#set: total reaction=2}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: completion rate=50.0}}
{{#set: common name=24-methylenecholesterol}}
+
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: produced by=RXN-707}}
+

Latest revision as of 20:31, 21 March 2018

Pathway PWY-5443

  • taxonomic range:
  • common name:
    • aminopropanol phosphate biosynthesis I
  • Synonym(s):
    • 1-amino-propan-2-yl phosphate biosynthesis from threonine
    • (R)-1-amino-2-propanol O-2-phosphate biosynthesis

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links