Difference between revisions of "PWY-6731"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6731 PWY-6731] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6731 PWY-6731] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(9Z)-octadecenoyl-CoA
+
** starch degradation III
* molecular weight:
+
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-18:1-Δ9-CoA
 
** 3-oxo-9-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17778]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PHOSPHOGLUCMUT-RXN]]
* [[RXN-17777]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_4816]]
 +
*** [[Tiso_gene_13477]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-12171]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1011]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=CYCLOMALTODEXTRINASE-RXN CYCLOMALTODEXTRINASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12181 RXN-12181]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2157}}
{{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}}
+
{{#set: common name=starch degradation III}}
{{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}}
+
{{#set: reaction found=2}}
{{#set: molecular weight=1041.936    }}
+
{{#set: total reaction=4}}
{{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}}
+
{{#set: completion rate=50.0}}
{{#set: consumed by=RXN-17778}}
+
{{#set: produced by=RXN-17777}}
+

Latest revision as of 19:31, 21 March 2018

Pathway PWY-6731

  • taxonomic range:
  • common name:
    • starch degradation III
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links