Difference between revisions of "Tiso gene 19579"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == * smiles: ** CC(C(=O)C([O-])=O)(CO)C * inchi key: ** In...")
 
(Created page with "Category:Gene == Gene Tiso_gene_19579 == * Synonym(s): == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-athaliana == Pathways associated == *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] ==
+
== Gene Tiso_gene_19579 ==
* smiles:
+
** CC(C(=O)C([O-])=O)(CO)C
+
* inchi key:
+
** InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
+
* common name:
+
** 2-dehydropantoate
+
* molecular weight:
+
** 145.135   
+
 
* Synonym(s):
 
* Synonym(s):
** ketopantoate
 
** 2-ketopantoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-athaliana]]
* [[MTMOHT]]
+
== Pathways associated ==
* [[RXN-15635]]
+
* [[PWY-5381]]
* [[R01226]]
+
== Reaction(s) of unknown directionality ==
+
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
+
* [[KETOPANTOALDOLASE-RXN]]
+
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB03795
+
{{#set: reaction associated=RXN-8443}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-5381}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755619 16755619]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00966 C00966]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.14649571.html 14649571]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11561 11561]
+
* BIGG : 2dhp
+
{{#set: smiles=CC(C(=O)C([O-])=O)(CO)C}}
+
{{#set: inchi key=InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M}}
+
{{#set: common name=2-dehydropantoate}}
+
{{#set: molecular weight=145.135    }}
+
{{#set: common name=ketopantoate|2-ketopantoate}}
+
{{#set: consumed by=2-DEHYDROPANTOATE-REDUCT-RXN}}
+
{{#set: produced by=MTMOHT|RXN-15635|R01226}}
+
{{#set: consumed or produced by=3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN|KETOPANTOALDOLASE-RXN}}
+

Latest revision as of 19:31, 21 March 2018

Gene Tiso_gene_19579

  • Synonym(s):

Reactions associated

Pathways associated

External links