Difference between revisions of "CPD-11407"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6471 PWY-6471] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186826 TAX-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6471 PWY-6471] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186826 TAX-186826]
+
** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
 
* common name:
 
* common name:
** peptidoglycan biosynthesis IV (Enterococcus faecium)
+
** thyroxine sulfate
 +
* inchi key:
 +
** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
 +
* molecular weight:
 +
** 855.924   
 
* Synonym(s):
 
* Synonym(s):
 +
** T4 sulfate
 +
** thyroxine-4-sulfate
 +
** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''10''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[PWY-6386]]
+
* [[RXN-10614]]
** 0 associated gene:
+
== Reaction(s) of unknown directionality ==
* [[RXN-11351]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_18870]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
* [[RXN-8975]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_1604]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-esiliculosus]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6461 PWY-6461]
+
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6461 PWY-6461]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11339 RXN-11339]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11350 RXN-11350]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15521 RXN-15521]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8976 RXN-8976]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-186826}}
+
* PUBCHEM:
{{#set: common name=peptidoglycan biosynthesis IV (Enterococcus faecium)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726]
{{#set: reaction found=3}}
+
* CHEBI:
{{#set: total reaction=10}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910]
{{#set: completion rate=30.0}}
+
{{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}}
 +
{{#set: common name=thyroxine sulfate}}
 +
{{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}}
 +
{{#set: molecular weight=855.924    }}
 +
{{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}}
 +
{{#set: produced by=RXN-10614}}

Latest revision as of 19:31, 21 March 2018

Metabolite CPD-11407

  • smiles:
    • C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
  • common name:
    • thyroxine sulfate
  • inchi key:
    • InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
  • molecular weight:
    • 855.924
  • Synonym(s):
    • T4 sulfate
    • thyroxine-4-sulfate
    • L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)" cannot be used as a page name in this wiki.