Difference between revisions of "CPD-11407"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6471 PWY-6471] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-186826 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == |
− | * | + | * smiles: |
− | ** [ | + | ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I) |
* common name: | * common name: | ||
− | ** | + | ** thyroxine sulfate |
+ | * inchi key: | ||
+ | ** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M | ||
+ | * molecular weight: | ||
+ | ** 855.924 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** T4 sulfate | ||
+ | ** thyroxine-4-sulfate | ||
+ | ** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo- | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10614]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910] |
− | {{#set: | + | {{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}} |
+ | {{#set: common name=thyroxine sulfate}} | ||
+ | {{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}} | ||
+ | {{#set: molecular weight=855.924 }} | ||
+ | {{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}} | ||
+ | {{#set: produced by=RXN-10614}} |
Latest revision as of 20:31, 21 March 2018
Contents
Metabolite CPD-11407
- smiles:
- C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
- common name:
- thyroxine sulfate
- inchi key:
- InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
- molecular weight:
- 855.924
- Synonym(s):
- T4 sulfate
- thyroxine-4-sulfate
- L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)" cannot be used as a page name in this wiki.