Difference between revisions of "GLYCINE-DEHYDROGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-DEHYDROGENASE-RXN GLYCINE-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE * common name: *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-DEHYDROGENASE-RXN GLYCINE-DEHYDROGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glycine_dehydrogenase_mitochondrial |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.4.1.10 EC-1.4.1.10] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[GLY]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[GLYOX]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 glycine[c] '''<=>''' 1 NADH[c] '''+''' 1 ammonium[c] '''+''' 1 H+[c] '''+''' 1 glyoxylate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_428]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15721 15721] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00365 R00365] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: common name=glycine_dehydrogenase_mitochondrial}} |
− | {{#set: | + | {{#set: ec number=EC-1.4.1.10}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_428}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
+ | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:31, 21 March 2018
Contents
Reaction GLYCINE-DEHYDROGENASE-RXN
- direction:
- REVERSIBLE
- common name:
- glycine_dehydrogenase_mitochondrial
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NAD+[c] + 1 H2O[c] + 1 glycine[c] <=> 1 NADH[c] + 1 ammonium[c] + 1 H+[c] + 1 glyoxylate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_428
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links