Difference between revisions of "CPD-724"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12360 == * left end position: ** 126 * transcription direction: ** POSITIVE * right end position: ** 1966 * centisome position: ** 1.772152...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)C...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * common name: |
| − | ** | + | ** 6α-hydroxy-castasterone |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 466.7 |
* Synonym(s): | * Synonym(s): | ||
| + | ** hydroxydeoxocastasterone | ||
| + | ** 6α-hydroxy-6-deoxocastasterone | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-779]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-778]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15542699 15542699] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20760 20760] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15803 C15803] | ||
| + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=6α-hydroxy-castasterone}} | ||
| + | {{#set: inchi key=InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N}} | ||
| + | {{#set: molecular weight=466.7 }} | ||
| + | {{#set: common name=hydroxydeoxocastasterone|6α-hydroxy-6-deoxocastasterone}} | ||
| + | {{#set: consumed by=RXN-779}} | ||
| + | {{#set: produced by=RXN-778}} | ||
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite CPD-724
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
- common name:
- 6α-hydroxy-castasterone
- inchi key:
- InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
- molecular weight:
- 466.7
- Synonym(s):
- hydroxydeoxocastasterone
- 6α-hydroxy-6-deoxocastasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
