Difference between revisions of "2-DEHYDROPANTOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1132 RXN0-1132] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == * smiles: ** CC(C(=O)C([O-])=O)(CO)C * common name: **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1132 RXN0-1132] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C(=O)C([O-])=O)(CO)C
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.8.1.4 EC-1.8.1.4]
+
** 2-dehydropantoate
 +
* inchi key:
 +
** InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 145.135   
 
* Synonym(s):
 
* Synonym(s):
 +
** ketopantoate
 +
** 2-ketopantoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
−
** 1 [[NAD]][c] '''+''' 1 [[Pyruvate-dehydrogenase-dihydrolipoate]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pyruvate-dehydrogenase-lipoate]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[MTMOHT]]
−
** 1 NAD+[c] '''+''' 1 a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine[c] '''=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine[c]
+
* [[RXN-15635]]
−
 
+
* [[R01226]]
−
== Genes associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
−
Genes have been associated with this reaction based on different elements listed below.
+
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
−
* [[Tiso_gene_9330]]
+
* [[KETOPANTOALDOLASE-RXN]]
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PYRUVDEHYD-PWY]], pyruvate decarboxylation to acetyl CoA: [http://metacyc.org/META/NEW-IMAGE?object=PYRUVDEHYD-PWY PYRUVDEHYD-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB03795
−
{{#set: ec number=EC-1.8.1.4}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_9330}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755619 16755619]
−
{{#set: in pathway=PYRUVDEHYD-PWY}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00966 C00966]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.chemspider.com/Chemical-Structure.14649571.html 14649571]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11561 11561]
−
{{#set: reconstruction source=in-silico_annotation}}
+
* BIGG : 2dhp
 +
{{#set: smiles=CC(C(=O)C([O-])=O)(CO)C}}
 +
{{#set: common name=2-dehydropantoate}}
 +
{{#set: inchi key=InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=145.135    }}
 +
{{#set: common name=ketopantoate|2-ketopantoate}}
 +
{{#set: consumed by=2-DEHYDROPANTOATE-REDUCT-RXN}}
 +
{{#set: produced by=MTMOHT|RXN-15635|R01226}}
 +
{{#set: reversible reaction associated=3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN|KETOPANTOALDOLASE-RXN}}

Latest revision as of 19:32, 21 March 2018

Metabolite 2-DEHYDROPANTOATE

  • smiles:
    • CC(C(=O)C([O-])=O)(CO)C
  • common name:
    • 2-dehydropantoate
  • inchi key:
    • InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
  • molecular weight:
    • 145.135
  • Synonym(s):
    • ketopantoate
    • 2-ketopantoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(=O)C([O-])=O)(CO)C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-DEHYDROPANTOATE&oldid=42221"