Difference between revisions of "Tiso gene 20348"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...")
(Created page with "Category:Gene == Gene Tiso_gene_20348 == * right end position: ** 589 * transcription direction: ** POSITIVE * left end position: ** 224 * centisome position: ** 15.11471...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] ==
+
== Gene Tiso_gene_20348 ==
−
* smiles:
+
* right end position:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 589
−
* common name:
+
* transcription direction:
−
** 6-deoxocathasterone
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
+
** 224
−
* molecular weight:
+
* centisome position:
−
** 418.702    
+
** 15.11471    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxocathasterone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-774]]
+
* Reaction: [[KDO-8PSYNTH-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-773]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7674]]
 +
* [[PWY-1269]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01030124
+
{{#set: right end position=589}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061344 16061344]
+
{{#set: left end position=224}}
−
* CHEBI:
+
{{#set: centisome position=15.11471   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714]
+
{{#set: reaction associated=KDO-8PSYNTH-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7674|PWY-1269}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798]
+
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: common name=6-deoxocathasterone}}
+
−
{{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}}
+
−
{{#set: molecular weight=418.702   }}
+
−
{{#set: common name=deoxocathasterone}}
+
−
{{#set: consumed by=RXN-774}}
+
−
{{#set: produced by=RXN-773}}
+

Latest revision as of 19:32, 21 March 2018

Gene Tiso_gene_20348

  • right end position:
    • 589
  • transcription direction:
    • POSITIVE
  • left end position:
    • 224
  • centisome position:
    • 15.11471
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_20348&oldid=42254"