Difference between revisions of "Tiso gene 11397"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * smiles: ** C([O-])(=O)CC1(=CNC2(C=CC=CC1=2)) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_11397 == * right end position: ** 4552 * transcription direction: ** NEGATIVE * left end position: ** 2 * centisome position: ** 2.56049160...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11397 == |
− | * | + | * right end position: |
− | ** | + | ** 4552 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 2 |
− | * | + | * centisome position: |
− | ** | + | ** 2.560491600e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: automated-name-match | |
− | + | == Pathways associated == | |
− | * [[ | + | |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=4552}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=2}} | |
− | + | {{#set: centisome position=2.560491600e-2}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Gene Tiso_gene_11397
- right end position:
- 4552
- transcription direction:
- NEGATIVE
- left end position:
- 2
- centisome position:
- 2.560491600e-2
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation