Difference between revisions of "Tiso gene 19883"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_19883 == * right end position: ** 1172 * transcription direction: ** POSITIVE * left end position: ** 61 * centisome position: ** 3.12981...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19883 == |
− | * | + | * right end position: |
− | ** | + | ** 1172 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 61 |
− | * | + | * centisome position: |
− | ** | + | ** 3.12981 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[RXN- | + | *** Assignment: ec-number |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | * Reaction: [[RXN-11201]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1172}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=61}} | |
− | + | {{#set: centisome position=3.12981 }} | |
− | + | {{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN|RXN-11201}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:32, 21 March 2018
Gene Tiso_gene_19883
- right end position:
- 1172
- transcription direction:
- POSITIVE
- left end position:
- 61
- centisome position:
- 3.12981
- Synonym(s):
Reactions associated
- Reaction: HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-11201
- Source: orthology-esiliculosus