Difference between revisions of "CPD-6991"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7631 == * left end position: ** 47 * transcription direction: ** POSITIVE * right end position: ** 5450 * centisome position: ** 0.42883214...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * common n...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == |
− | * | + | * smiles: |
− | ** | + | ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) |
− | * | + | * common name: |
− | ** | + | ** (2S)-pinocembrin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 255.249 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7648]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-7647]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPK12140214 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200438 25200438] |
− | {{#set: | + | * HMDB : HMDB30808 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C09827 C09827] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28157 28157] | ||
+ | * METABOLIGHTS : MTBLC28157 | ||
+ | {{#set: smiles=C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)}} | ||
+ | {{#set: common name=(2S)-pinocembrin}} | ||
+ | {{#set: inchi key=InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M}} | ||
+ | {{#set: molecular weight=255.249 }} | ||
+ | {{#set: consumed by=RXN-7648}} | ||
+ | {{#set: produced by=RXN-7647}} |
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite CPD-6991
- smiles:
- C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)
- common name:
- (2S)-pinocembrin
- inchi key:
- InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M
- molecular weight:
- 255.249
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPK12140214
- PUBCHEM:
- HMDB : HMDB30808
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC28157
"C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)" cannot be used as a page name in this wiki.