Difference between revisions of "CGMP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17781 RXN-17781] == * direction: ** LEFT-TO-RIGHT * common name: ** hydroxyacyl-coenzyme_a_dehy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * smiles: ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) * co...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == |
− | * | + | * smiles: |
− | ** | + | ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) |
* common name: | * common name: | ||
− | ** | + | ** cyclic-GMP |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 344.2 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3',5'-cyclic GMP | ||
+ | ** guanosine-cyclic-phosphoric-acid | ||
+ | ** cGMP | ||
+ | ** guanosine cyclic-monophosphate | ||
+ | ** guanosine 3',5'-cyclic-monophosphate | ||
+ | ** guanosine 3',5'-cyclic phosphate | ||
+ | ** cyclic 3',5'-guanosine monophosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[GUANYLCYC-RXN]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 7665-99-8 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16727415 16727415] |
− | {{#set: | + | * HMDB : HMDB01314 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00942 C00942] |
− | {{#set: | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.20559156.html 20559156] | |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57746 57746] |
+ | * METABOLIGHTS : MTBLC57746 | ||
+ | {{#set: smiles=C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))}} | ||
+ | {{#set: common name=cyclic-GMP}} | ||
+ | {{#set: inchi key=InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M}} | ||
+ | {{#set: molecular weight=344.2 }} | ||
+ | {{#set: common name=3',5'-cyclic GMP|guanosine-cyclic-phosphoric-acid|cGMP|guanosine cyclic-monophosphate|guanosine 3',5'-cyclic-monophosphate|guanosine 3',5'-cyclic phosphate|cyclic 3',5'-guanosine monophosphate}} | ||
+ | {{#set: consumed by=35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN}} | ||
+ | {{#set: reversible reaction associated=GUANYLCYC-RXN}} |
Latest revision as of 20:33, 21 March 2018
Contents
Metabolite CGMP
- smiles:
- C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))
- common name:
- cyclic-GMP
- inchi key:
- InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M
- molecular weight:
- 344.2
- Synonym(s):
- 3',5'-cyclic GMP
- guanosine-cyclic-phosphoric-acid
- cGMP
- guanosine cyclic-monophosphate
- guanosine 3',5'-cyclic-monophosphate
- guanosine 3',5'-cyclic phosphate
- cyclic 3',5'-guanosine monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7665-99-8
- PUBCHEM:
- HMDB : HMDB01314
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57746
"C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))" cannot be used as a page name in this wiki.