Difference between revisions of "Tiso gene 7506"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_7506 == * right end position: ** 10982 * transcription direction: ** POSITIVE * left end position: ** 9439 * centisome position: ** 85.0973...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
+
== Gene Tiso_gene_7506 ==
−
* smiles:
+
* right end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
+
** 10982
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 4α-carboxy-5α-cholesta-8-en-3β-ol
+
** 9439
−
* molecular weight:
+
* centisome position:
−
** 429.662    
+
** 85.09737    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-23]]
+
* Reaction: [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10982}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826593 91826593]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=9439}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87055 87055]
+
{{#set: centisome position=85.09737    }}
−
* HMDB : HMDB12166
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
+
−
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
+
−
{{#set: molecular weight=429.662    }}
+
−
{{#set: consumed by=RXN66-23}}
+

Latest revision as of 19:33, 21 March 2018

Gene Tiso_gene_7506

  • right end position:
    • 10982
  • transcription direction:
    • POSITIVE
  • left end position:
    • 9439
  • centisome position:
    • 85.09737
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7506&oldid=42329"