Difference between revisions of "PWY-6039"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PTEROATE PTEROATE] == * smiles: ** C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6039 PWY-6039] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PTEROATE PTEROATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6039 PWY-6039] ==
* smiles:
+
* taxonomic range:
** C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-24966 TAX-24966]
** InChIKey=JOAQINSXLLMRCV-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** pteroate
+
** chlorogenic acid biosynthesis I
* molecular weight:
+
** 311.279   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}benzoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''7''' reactions in the full pathway
* [[3.4.17.11-RXN]]
+
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_10561]]
 +
*** [[Tiso_gene_14561]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.14.13.36-RXN 1.14.13.36-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.133-RXN 2.3.1.133-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2581 RXN-2581]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2601 RXN-2601]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2621 RXN-2621]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2622 RXN-2622]
 
== External links  ==
 
== External links  ==
* CAS : 119-24-4
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-24966}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6951470 6951470]
+
{{#set: common name=chlorogenic acid biosynthesis I}}
* CHEMSPIDER:
+
{{#set: reaction found=1}}
** [http://www.chemspider.com/Chemical-Structure.5324366.html 5324366]
+
{{#set: total reaction=7}}
* CHEBI:
+
{{#set: completion rate=14.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38793 38793]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C07582 C07582]
+
{{#set: smiles=C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))}}
+
{{#set: inchi key=InChIKey=JOAQINSXLLMRCV-UHFFFAOYSA-M}}
+
{{#set: common name=pteroate}}
+
{{#set: molecular weight=311.279    }}
+
{{#set: common name=4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}benzoate}}
+
{{#set: produced by=3.4.17.11-RXN}}
+

Latest revision as of 19:33, 21 March 2018

Pathway PWY-6039

  • taxonomic range:
  • common name:
    • chlorogenic acid biosynthesis I
  • Synonym(s):

Reaction(s) found

1 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links