Difference between revisions of "RXN-17848"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23))) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17848 RXN-17848] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** leucyl_phenylalanyl-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17848 RXN-17848] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ORF |
| − | * | + | ** leucyl_phenylalanyl-trna--protein_transferase |
| − | ** | + | ** leucyl_phenylalanyl-trna--protein |
| + | * ec number: | ||
| + | ** [http://enzyme.expasy.org/EC/2.3.2.6 EC-2.3.2.6] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[Protein-N-terminal-L-Lysine]][c] '''+''' 1 [[Charged-PHE-tRNAs]][c] '''=>''' 1 [[L-phenylalanyl-L-lysyl-Protein]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PHE-tRNAs]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an N-terminal L-lysyl-[protein][c] '''+''' 1 an L-phenylalanyl-[tRNAphe][c] '''=>''' 1 L-phenylalanyl-L-lysyl-[protein][c] '''+''' 1 H+[c] '''+''' 1 a tRNAphe[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_2584]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_13698]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_8540]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=ORF}} | |
| − | + | {{#set: common name=leucyl_phenylalanyl-trna--protein_transferase}} | |
| − | + | {{#set: common name=leucyl_phenylalanyl-trna--protein}} | |
| − | + | {{#set: ec number=EC-2.3.2.6}} | |
| − | + | {{#set: gene associated=Tiso_gene_2584|Tiso_gene_13698|Tiso_gene_8540}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:33, 21 March 2018
Contents
Reaction RXN-17848
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- leucyl_phenylalanyl-trna--protein_transferase
- leucyl_phenylalanyl-trna--protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Protein-N-terminal-L-Lysine[c] + 1 Charged-PHE-tRNAs[c] => 1 L-phenylalanyl-L-lysyl-Protein[c] + 1 PROTON[c] + 1 PHE-tRNAs[c]
- With common name(s):
- 1 an N-terminal L-lysyl-[protein][c] + 1 an L-phenylalanyl-[tRNAphe][c] => 1 L-phenylalanyl-L-lysyl-[protein][c] + 1 H+[c] + 1 a tRNAphe[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2584
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13698
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8540
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
