Difference between revisions of "Tiso gene 4653"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * inchi key: ** InChIKey=WKZWTZT...") |
(Created page with "Category:Gene == Gene Tiso_gene_4653 == * right end position: ** 9203 * transcription direction: ** POSITIVE * left end position: ** 6810 * centisome position: ** 46.62787...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4653 == |
− | * | + | * right end position: |
− | ** | + | ** 9203 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 6810 |
− | * | + | * centisome position: |
− | ** | + | ** 46.62787 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-11989]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN-11999]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-13374]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-698]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-7973]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-7974]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6681]] | ||
+ | * [[PWY-695]] | ||
+ | * [[PWY-6857]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=9203}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=6810}} | |
− | + | {{#set: centisome position=46.62787 }} | |
− | + | {{#set: reaction associated=RXN-11989|RXN-11999|RXN-13374|RXN-698|RXN-7973|RXN-7974}} | |
− | + | {{#set: pathway associated=PWY-6681|PWY-695|PWY-6857}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:34, 21 March 2018
Gene Tiso_gene_4653
- right end position:
- 9203
- transcription direction:
- POSITIVE
- left end position:
- 6810
- centisome position:
- 46.62787
- Synonym(s):
Reactions associated
- Reaction: RXN-11989
- Source: orthology-esiliculosus
- Reaction: RXN-11999
- Source: orthology-esiliculosus
- Reaction: RXN-13374
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-698
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-7973
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-7974
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation