Difference between revisions of "Tiso gene 4653"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * inchi key: ** InChIKey=WKZWTZT...")
(Created page with "Category:Gene == Gene Tiso_gene_4653 == * right end position: ** 9203 * transcription direction: ** POSITIVE * left end position: ** 6810 * centisome position: ** 46.62787...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] ==
+
== Gene Tiso_gene_4653 ==
−
* smiles:
+
* right end position:
−
** C=C(C1(CC(C(CC1)(O)C)O))C
+
** 9203
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (1R,2R,4S)-limonene-1,2-diol
+
** 6810
−
* molecular weight:
+
* centisome position:
−
** 170.251    
+
** 46.62787    
 
* Synonym(s):
 
* Synonym(s):
−
** (1S,2S,4R)-menth-8-ene-1,2-diol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-11989]]
−
* [[RXN-9413]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-11999]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13374]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-698]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7973]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7974]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6681]]
 +
* [[PWY-695]]
 +
* [[PWY-6857]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=9203}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19082 C19082]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=6810}}
−
** [http://www.chemspider.com/Chemical-Structure.9392549.html 9392549]
+
{{#set: centisome position=46.62787   }}
−
* CHEBI:
+
{{#set: reaction associated=RXN-11989|RXN-11999|RXN-13374|RXN-698|RXN-7973|RXN-7974}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50244 50244]
+
{{#set: pathway associated=PWY-6681|PWY-695|PWY-6857}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11217495 11217495]
+
−
{{#set: smiles=C=C(C1(CC(C(CC1)(O)C)O))C}}
+
−
{{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N}}
+
−
{{#set: common name=(1R,2R,4S)-limonene-1,2-diol}}
+
−
{{#set: molecular weight=170.251   }}
+
−
{{#set: common name=(1S,2S,4R)-menth-8-ene-1,2-diol}}
+
−
{{#set: produced by=RXN-9413}}
+

Latest revision as of 19:34, 21 March 2018

Gene Tiso_gene_4653

  • right end position:
    • 9203
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6810
  • centisome position:
    • 46.62787
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4653&oldid=42417"