Difference between revisions of "ENT-KAUR-16-EN-19-AL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13608 RXN-13608] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13608 RXN-13608] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-AL ENT-KAUR-16-EN-19-AL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))
 
* common name:
 
* common name:
−
** exostosin_family_protein
+
** ent-kaurenal
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
+
** InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N
 +
* molecular weight:
 +
** 286.456   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-kaur-16-en-19-al
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7580]]
−
** 1 [[CPD-14601]][c] '''+''' 1 [[UDP-GLUCURONATE]][c] '''=>''' 1 [[CPD-14604]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-5242]]
−
** 1 mycophenolate[c] '''+''' 1 UDP-α-D-glucuronate[c] '''=>''' 1 mycophenolic acid phenolic glucuronide[c] '''+''' 1 H+[c] '''+''' 1 UDP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14140]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_14141]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=exostosin_family_protein}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443466 443466]
−
{{#set: ec number=EC-2.4.1.17}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_14140|Tiso_gene_14141}}
+
** [http://www.chemspider.com/Chemical-Structure.391680.html 391680]
−
{{#set: in pathway=}}
+
* HMDB : HMDB36728
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29609 29609]
−
{{#set: reconstruction source=in-silico_annotation}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11873 C11873]
 +
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))}}
 +
{{#set: common name=ent-kaurenal}}
 +
{{#set: inchi key=InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N}}
 +
{{#set: molecular weight=286.456    }}
 +
{{#set: common name=ent-kaur-16-en-19-al}}
 +
{{#set: consumed by=RXN-7580}}
 +
{{#set: produced by=RXN-5242}}

Latest revision as of 19:34, 21 March 2018

Metabolite ENT-KAUR-16-EN-19-AL

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))
  • common name:
    • ent-kaurenal
  • inchi key:
    • InChIKey=JCAVDWHQNFTFBW-XRNRSJMDSA-N
  • molecular weight:
    • 286.456
  • Synonym(s):
    • ent-kaur-16-en-19-al

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ENT-KAUR-16-EN-19-AL&oldid=42450"