Difference between revisions of "CHLOROPHYLL-SYN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-]...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
−
** InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** α-glucose 1,6-bisphosphate
+
** 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)
−
* molecular weight:
+
−
** 336.085   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α-D-glucose 1,6-P2
+
** light-dependent aerobic 3,8-divinyl-chlorophyllide a biosynthesis I
−
** α-D-glucopyranose 1,6-bisphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-16998]]
+
'''9''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[PROTOPORGENOXI-RXN]]
−
* [[RXN-16997]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_11986]]
 +
*** [[Tiso_gene_15401]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[RXN-5282]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
* [[RXN-5283]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
* [[RXN-5284]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
* [[RXN-5285]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_17141]]
 +
*** [[Tiso_gene_19518]]
 +
*** [[Tiso_gene_10077]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_19451]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN0-1461]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_3671]]
 +
*** [[Tiso_gene_2247]]
 +
*** [[Tiso_gene_13364]]
 +
*** [[Tiso_gene_13365]]
 +
*** [[Tiso_gene_2246]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN1F-20]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_11960]]
 +
*** [[Tiso_gene_5993]]
 +
*** [[Tiso_gene_9870]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
* [[UROGENDECARBOX-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18743]]
 +
*** [[Tiso_gene_19684]]
 +
*** [[Tiso_gene_18744]]
 +
*** [[Tiso_gene_5173]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 10139-18-1
+
{{#set: taxonomic range=TAX-2763}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33682}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201676 25201676]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58392 58392]
+
{{#set: common name=3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)}}
−
* LIGAND-CPD:
+
{{#set: common name=light-dependent aerobic 3,8-divinyl-chlorophyllide a biosynthesis I}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01231 C01231]
+
{{#set: reaction found=9}}
−
* HMDB : HMDB03514
+
{{#set: total reaction=9}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])}}
+
{{#set: completion rate=100.0}}
−
{{#set: inchi key=InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J}}
+
−
{{#set: common name=α-glucose 1,6-bisphosphate}}
+
−
{{#set: molecular weight=336.085    }}
+
−
{{#set: common name=α-D-glucose 1,6-P2|α-D-glucopyranose 1,6-bisphosphate}}
+
−
{{#set: consumed by=RXN-16998}}
+
−
{{#set: produced by=RXN-16997}}
+

Latest revision as of 19:34, 21 March 2018

Pathway CHLOROPHYLL-SYN

  • taxonomic range:
  • common name:
    • 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)
  • Synonym(s):
    • light-dependent aerobic 3,8-divinyl-chlorophyllide a biosynthesis I

Reaction(s) found

9 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CHLOROPHYLL-SYN&oldid=42452"