Difference between revisions of "CPD-667"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-form-FeS-Cluster-Scaffold-Proteins D-form-FeS-Cluster-Scaffold-Proteins] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * smiles: ** CC(OCCC(C([O-])=O)[N+])=O * common name: ** O-acetyl-L-homoser...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == |
+ | * smiles: | ||
+ | ** CC(OCCC(C([O-])=O)[N+])=O | ||
* common name: | * common name: | ||
− | ** | + | ** O-acetyl-L-homoserine |
+ | * inchi key: | ||
+ | ** InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N | ||
+ | * molecular weight: | ||
+ | ** 161.157 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** acetylhomoserine | ||
+ | ** O-acetylhomoserine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ACHMSSELCYSL]] |
+ | * [[ACHMSSELCYSLh]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[ACETYLHOMOSER-CYS-RXN]] | ||
+ | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244888 25244888] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57716 57716] | ||
+ | * METABOLIGHTS : MTBLC57716 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01077 C01077] | ||
+ | {{#set: smiles=CC(OCCC(C([O-])=O)[N+])=O}} | ||
+ | {{#set: common name=O-acetyl-L-homoserine}} | ||
+ | {{#set: inchi key=InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N}} | ||
+ | {{#set: molecular weight=161.157 }} | ||
+ | {{#set: common name=acetylhomoserine|O-acetylhomoserine}} | ||
+ | {{#set: consumed by=ACHMSSELCYSL|ACHMSSELCYSLh}} | ||
+ | {{#set: reversible reaction associated=ACETYLHOMOSER-CYS-RXN|HOMOSERINE-O-ACETYLTRANSFERASE-RXN}} |
Latest revision as of 19:34, 21 March 2018
Contents
Metabolite CPD-667
- smiles:
- CC(OCCC(C([O-])=O)[N+])=O
- common name:
- O-acetyl-L-homoserine
- inchi key:
- InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N
- molecular weight:
- 161.157
- Synonym(s):
- acetylhomoserine
- O-acetylhomoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(OCCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.