Difference between revisions of "Tiso gene 12019"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * inchi key: ** InChIKey=PX...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12019 == * Synonym(s): == Reactions associated == * Reaction: 3.1.4.11-RXN ** Source: orthology-esiliculosus * Reaction: RXN-133...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] ==
+
== Gene Tiso_gene_12019 ==
* smiles:
+
** C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
+
* inchi key:
+
** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
+
* common name:
+
** 7,8-dihydropterin
+
* molecular weight:
+
** 165.154   
+
 
* Synonym(s):
 
* Synonym(s):
** dihydropterin
 
** H2-pterin
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-15261]]
+
* Reaction: [[3.1.4.11-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-13334]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6367]]
 +
* [[PWY-6351]]
 +
* [[PWY-7039]]
 +
* [[LIPASYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3.1.4.11-RXN|RXN-13334}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260]
+
{{#set: pathway associated=PWY-6367|PWY-6351|PWY-7039|LIPASYN-PWY}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.58752.html 58752]
+
{{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}}
+
{{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}}
+
{{#set: common name=7,8-dihydropterin}}
+
{{#set: molecular weight=165.154    }}
+
{{#set: common name=dihydropterin|H2-pterin}}
+
{{#set: consumed by=RXN-15261}}
+

Latest revision as of 20:34, 21 March 2018

Gene Tiso_gene_12019

  • Synonym(s):

Reactions associated

Pathways associated

External links