Difference between revisions of "Tiso gene 3446"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3446 == * right end position: ** 12324 * transcription direction: ** POSITIVE * left end position: ** 11595 * centisome position: ** 69.518...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] ==
+
== Gene Tiso_gene_3446 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** 12324
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** aldehydo-D-glucose
+
** 11595
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 69.518555    
 
* Synonym(s):
 
* Synonym(s):
−
** (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
 
−
** linear D-glucose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14408]]
+
* Reaction: [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6164]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=12324}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107526 107526]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=11595}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42758 42758]
+
{{#set: centisome position=69.518555   }}
−
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
{{#set: reaction associated=3-DEHYDROQUINATE-SYNTHASE-RXN}}
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N}}
+
{{#set: pathway associated=PWY-6164}}
−
{{#set: common name=aldehydo-D-glucose}}
+
−
{{#set: molecular weight=180.157   }}
+
−
{{#set: common name=(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal|linear D-glucose}}
+
−
{{#set: consumed by=RXN-14408}}
+

Latest revision as of 19:34, 21 March 2018

Gene Tiso_gene_3446

  • right end position:
    • 12324
  • transcription direction:
    • POSITIVE
  • left end position:
    • 11595
  • centisome position:
    • 69.518555
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3446&oldid=42485"