Difference between revisions of "Tiso gene 3446"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Gene == Gene Tiso_gene_3446 == * right end position: ** 12324 * transcription direction: ** POSITIVE * left end position: ** 11595 * centisome position: ** 69.518...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3446 == |
− | * | + | * right end position: |
− | ** | + | ** 12324 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 11595 |
− | * | + | * centisome position: |
− | ** | + | ** 69.518555 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3-DEHYDROQUINATE-SYNTHASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-6164]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=12324}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=11595}} | |
− | + | {{#set: centisome position=69.518555 }} | |
− | {{#set: | + | {{#set: reaction associated=3-DEHYDROQUINATE-SYNTHASE-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-6164}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:34, 21 March 2018
Gene Tiso_gene_3446
- right end position:
- 12324
- transcription direction:
- POSITIVE
- left end position:
- 11595
- centisome position:
- 69.518555
- Synonym(s):
Reactions associated
- Reaction: 3-DEHYDROQUINATE-SYNTHASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation