Difference between revisions of "PWY-7085"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * smiles: ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7085 PWY-7085] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7085 PWY-7085] ==
* smiles:
+
* taxonomic range:
** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
+
 
* common name:
 
* common name:
** (2E)-5-methylhexa-2,4-dienoyl-CoA
+
** triethylamine degradation
* molecular weight:
+
** 871.642   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-11919]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETALD-DEHYDROG-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_7649]]
 +
*** [[Tiso_gene_2052]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13590 RXN-13590]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13591 RXN-13591]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13592 RXN-13592]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13593 RXN-13593]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13594 RXN-13594]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986176 50986176]
+
{{#set: common name=triethylamine degradation}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468]
+
{{#set: total reaction=6}}
{{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: completion rate=17.0}}
{{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}}
+
{{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}}
+
{{#set: molecular weight=871.642    }}
+
{{#set: consumed by=RXN-11919}}
+

Latest revision as of 20:34, 21 March 2018

Pathway PWY-7085

  • taxonomic range:
  • common name:
    • triethylamine degradation
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links