Difference between revisions of "Tiso gene 17216"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_17216 == * right end position: ** 3672 * transcription direction: ** POSITIVE * left end position: ** 2433 * centisome position: ** 63.2934...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] ==
+
== Gene Tiso_gene_17216 ==
−
* smiles:
+
* right end position:
−
** C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])
+
** 3672
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** α-glucose 1,6-bisphosphate
+
** 2433
−
* molecular weight:
+
* centisome position:
−
** 336.085    
+
** 63.293446    
 
* Synonym(s):
 
* Synonym(s):
−
** α-D-glucose 1,6-P2
 
−
** α-D-glucopyranose 1,6-bisphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16998]]
+
* Reaction: [[6.3.4.10-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN-16997]]
+
* Reaction: [[6.3.4.11-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[6.3.4.9-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[BIOTINLIG-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13039]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17127]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-8654]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-8655]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN0-1141]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN0-5098]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6984]]
 +
* [[PWY0-1264]]
 +
* [[PWY0-522]]
 +
* [[PWY0-1275]]
 
== External links  ==
 
== External links  ==
−
* CAS : 10139-18-1
+
{{#set: right end position=3672}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201676 25201676]
+
{{#set: left end position=2433}}
−
* CHEBI:
+
{{#set: centisome position=63.293446   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58392 58392]
+
{{#set: reaction associated=6.3.4.10-RXN|6.3.4.11-RXN|6.3.4.9-RXN|BIOTINLIG-RXN|RXN-13039|RXN-17127|RXN-8654|RXN-8655|RXN0-1141|RXN0-5098}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6984|PWY0-1264|PWY0-522|PWY0-1275}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01231 C01231]
+
−
* HMDB : HMDB03514
+
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(OC(C(C(C1O)O)O)OP(=O)([O-])[O-])}}
+
−
{{#set: inchi key=InChIKey=RWHOZGRAXYWRNX-VFUOTHLCSA-J}}
+
−
{{#set: common name=α-glucose 1,6-bisphosphate}}
+
−
{{#set: molecular weight=336.085   }}
+
−
{{#set: common name=α-D-glucose 1,6-P2|α-D-glucopyranose 1,6-bisphosphate}}
+
−
{{#set: consumed by=RXN-16998}}
+
−
{{#set: produced by=RXN-16997}}
+

Latest revision as of 20:34, 21 March 2018

Gene Tiso_gene_17216

  • right end position:
    • 3672
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2433
  • centisome position:
    • 63.293446
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17216&oldid=42504"