Difference between revisions of "PWY-5923"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * common name: ** D...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5923 PWY-5923] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5923 PWY-5923] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** D- | + | ** limonene degradation I (D-limonene) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (+)-limonene degradation |
− | ** | + | ** (+)-(4R)-limonene degradation |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[3.3.2.8-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_15422]] |
− | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
− | * [ | + | *** [[annotation-in-silico_annotation]] |
− | * [[ | + | == Reaction(s) not found == |
− | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9406 RXN-9406] |
− | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9407 RXN-9407] |
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9410 RXN-9410] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9415 RXN-9415] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9417 RXN-9417] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9949 RXN-9949] | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-PWY : lim |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=limonene degradation I (D-limonene)}} | |
− | + | {{#set: common name=(+)-limonene degradation|(+)-(4R)-limonene degradation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=14.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name=D- | + | |
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:34, 21 March 2018
Pathway PWY-5923
- taxonomic range:
- common name:
- limonene degradation I (D-limonene)
- Synonym(s):
- (+)-limonene degradation
- (+)-(4R)-limonene degradation
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- 3.3.2.8-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- UM-BBD-PWY : lim