Difference between revisions of "1516-DIHYDROBILIVERDIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D19-37-C56-3-ACPs trans-D2-cis-cis-D19-37-C56-3-ACPs] == * common name: ** a t...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == |
| + | * smiles: | ||
| + | ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) | ||
* common name: | * common name: | ||
| − | ** | + | ** 15,16-dihydrobiliverdin |
| + | * inchi key: | ||
| + | ** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L | ||
| + | * molecular weight: | ||
| + | ** 582.655 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.3.7.3-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899] | ||
| + | {{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | ||
| + | {{#set: common name=15,16-dihydrobiliverdin}} | ||
| + | {{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}} | ||
| + | {{#set: molecular weight=582.655 }} | ||
| + | {{#set: consumed by=1.3.7.3-RXN}} | ||
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite 1516-DIHYDROBILIVERDIN
- smiles:
- C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- common name:
- 15,16-dihydrobiliverdin
- inchi key:
- InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
- molecular weight:
- 582.655
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.
