Difference between revisions of "1516-DIHYDROBILIVERDIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17021 RXN-17021] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17021 RXN-17021] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
 
* common name:
 
* common name:
** 1-acylglycerol-3-phosphate_o-acyltransferase
+
** 15,16-dihydrobiliverdin
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
+
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
 +
* molecular weight:
 +
** 582.655   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[1.3.7.3-RXN]]
** 1 [[CPD-18379]][c] '''+''' 1 [[TETRADECANOYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD0-1425]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 1-myristoylglycerol 3-phosphate[c] '''+''' 1 myristoyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 dimyristoyl phosphatidate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Tiso_gene_13959]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Assignment: EC-NUMBER
+
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: EC-NUMBER
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
** Source: [[annotation-experimental_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
{{#set: ec number=EC-2.3.1.51}}
+
* CHEBI:
{{#set: gene associated=Tiso_gene_13959}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
{{#set: in pathway=}}
+
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
{{#set: reconstruction category=annotation}}
+
{{#set: common name=15,16-dihydrobiliverdin}}
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=582.655    }}
 +
{{#set: consumed by=1.3.7.3-RXN}}

Latest revision as of 19:35, 21 March 2018

Metabolite 1516-DIHYDROBILIVERDIN

  • smiles:
    • C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
  • common name:
    • 15,16-dihydrobiliverdin
  • inchi key:
    • InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
  • molecular weight:
    • 582.655
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.