Difference between revisions of "CPD-15374"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * common name: ** aldehydo-D-gl...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)C(C(C(C(CO)O)O)O)O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** aldehydo-D-glucose |
| + | * inchi key: | ||
| + | ** InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| − | ** | + | ** linear D-glucose |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14408]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107526 107526] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42758 42758] |
| − | + | {{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}} | |
| − | + | {{#set: common name=aldehydo-D-glucose}} | |
| − | + | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N}} | |
| − | {{#set: smiles= | + | {{#set: molecular weight=180.157 }} |
| − | {{#set: | + | {{#set: common name=(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal|linear D-glucose}} |
| − | {{#set: | + | {{#set: consumed by=RXN-14408}} |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by=RXN- | + | |
| − | + | ||
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite CPD-15374
- smiles:
- [CH](=O)C(C(C(C(CO)O)O)O)O
- common name:
- aldehydo-D-glucose
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
- molecular weight:
- 180.157
- Synonym(s):
- (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
- linear D-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(C(C(C(CO)O)O)O)O" cannot be used as a page name in this wiki.
