Difference between revisions of "CPD-15374"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1321 RXN-1321] == * direction: ** LEFT-TO-RIGHT * common name: ** lipoxygenase * ec number: **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * common name: ** aldehydo-D-gl...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1321 RXN-1321] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** [CH](=O)C(C(C(C(CO)O)O)O)O
 
* common name:
 
* common name:
−
** lipoxygenase
+
** aldehydo-D-glucose
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.13.11.12 EC-1.13.11.12]
+
** InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
 +
* molecular weight:
 +
** 180.157   
 
* Synonym(s):
 
* Synonym(s):
 +
** (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
 +
** linear D-glucose
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14408]]
−
** 1 [[LINOLENIC_ACID]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-725]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 α-linolenate[c] '''+''' 1 oxygen[c] '''=>''' 1 13(S)-HPOTE[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_4463]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5410]], traumatin and (Z)-3-hexen-1-yl acetate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
+
−
** '''15''' reactions found over '''19''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34495 34495]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107526 107526]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07869 R07869]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42758 42758]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
−
{{#set: common name=lipoxygenase}}
+
{{#set: common name=aldehydo-D-glucose}}
−
{{#set: ec number=EC-1.13.11.12}}
+
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N}}
−
{{#set: gene associated=Tiso_gene_4463}}
+
{{#set: molecular weight=180.157    }}
−
{{#set: in pathway=PWY-5410|PWY-735}}
+
{{#set: common name=(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal|linear D-glucose}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-14408}}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:35, 21 March 2018

Metabolite CPD-15374

  • smiles:
    • [CH](=O)C(C(C(C(CO)O)O)O)O
  • common name:
    • aldehydo-D-glucose
  • inchi key:
    • InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
  • molecular weight:
    • 180.157
  • Synonym(s):
    • (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
    • linear D-glucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(C(C(C(CO)O)O)O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15374&oldid=42527"