Difference between revisions of "CPD-3946"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4836 == * Synonym(s): == Reactions associated == * NADH-DEHYDROG-A-RXN ** pantograph-esiliculosus == Pathways associated == *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] == |
| + | * smiles: | ||
| + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * common name: | ||
| + | ** (22S,24R)-22-hydroxy-5α-ergostan-3-one | ||
| + | * inchi key: | ||
| + | ** InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N | ||
| + | * molecular weight: | ||
| + | ** 416.686 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (22S)-22-hydroxy-5α-campestan-3-one | ||
| + | ** (22α)-hydroxy-5α-campestan-3-one | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-4230]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMST01031117 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878488 46878488] | ||
| + | * HMDB : HMDB12112 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59411 59411] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15797 C15797] | ||
| + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=(22S,24R)-22-hydroxy-5α-ergostan-3-one}} | ||
| + | {{#set: inchi key=InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N}} | ||
| + | {{#set: molecular weight=416.686 }} | ||
| + | {{#set: common name=(22S)-22-hydroxy-5α-campestan-3-one|(22α)-hydroxy-5α-campestan-3-one}} | ||
| + | {{#set: produced by=RXN-4230}} | ||
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite CPD-3946
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- (22S,24R)-22-hydroxy-5α-ergostan-3-one
- inchi key:
- InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N
- molecular weight:
- 416.686
- Synonym(s):
- (22S)-22-hydroxy-5α-campestan-3-one
- (22α)-hydroxy-5α-campestan-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
