Difference between revisions of "RXN-15291"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == * smiles: ** C(C1(C(C(C(O1)(COP(=O)([O-])[O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15291 RXN-15291] == * direction: ** LEFT-TO-RIGHT * common name: ** luteolin monoglucuronide &b...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15291 RXN-15291] ==
−
* smiles:
+
* direction:
−
** C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J
+
 
* common name:
 
* common name:
−
** fructose 1,6-bisphosphate
+
** luteolin monoglucuronide β-glucuronidase
−
* molecular weight:
+
** beta-glucuronidase
−
** 336.085   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.2.1.31 EC-3.2.1.31]
 
* Synonym(s):
 
* Synonym(s):
−
** fructose 1,6-biphosphate
 
−
** fructose 1,6-diphosphate
 
−
** β-D-fructose 1,6-diphosphate
 
−
** D-fructose 1,6-diphosphate
 
−
** D-fructos 1,6-bisphosphate
 
−
** fructose 1,6-bisphosphate
 
−
** FBP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[F16BDEPHOS-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[LUTEOLIN-7-O-BETA-D-GLUCURONIDE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[5734-TETRAHYDROXYFLAVONE]][c] '''+''' 1 [[CPD-12521]][c]
−
* [[6PFRUCTPHOS-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 luteolin 7-O-β-D-glucuronide[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 luteolin[c] '''+''' 1 β-D-glucuronate[c]
−
* [[2.7.1.90-RXN]]
+
 
−
* [[F16ALDOLASE-RXN]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13087]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7445]], luteolin triglucuronide degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7445 PWY-7445]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 488-69-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* Wikipedia : Fructose_1,6-bisphosphate
+
{{#set: common name=luteolin monoglucuronide β-glucuronidase}}
−
* PUBCHEM:
+
{{#set: common name=beta-glucuronidase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460765 5460765]
+
{{#set: ec number=EC-3.2.1.31}}
−
* HMDB : HMDB01058
+
{{#set: gene associated=Tiso_gene_13087}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7445}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00354 C00354]
+
{{#set: reconstruction category=annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.4574223.html 4574223]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32966 32966]
+
−
* BIGG : fdp
+
−
{{#set: smiles=C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J}}
+
−
{{#set: common name=fructose 1,6-bisphosphate}}
+
−
{{#set: molecular weight=336.085    }}
+
−
{{#set: common name=fructose 1,6-biphosphate|fructose 1,6-diphosphate|β-D-fructose 1,6-diphosphate|D-fructose 1,6-diphosphate|D-fructos 1,6-bisphosphate|fructose 1,6-bisphosphate|FBP}}
+
−
{{#set: consumed by=F16BDEPHOS-RXN}}
+
−
{{#set: produced by=6PFRUCTPHOS-RXN}}
+
−
{{#set: reversible reaction associated=2.7.1.90-RXN|F16ALDOLASE-RXN}}
+

Latest revision as of 19:35, 21 March 2018

Reaction RXN-15291

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • luteolin monoglucuronide β-glucuronidase
    • beta-glucuronidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7445, luteolin triglucuronide degradation: PWY-7445
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15291&oldid=42563"