Difference between revisions of "D-GALACTONO-1-4-LACTONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7088 TAX-7088]
+
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
 
* common name:
 
* common name:
** (8E,10E)-dodeca-8,10-dienol biosynthesis
+
** D-galactono-1,4-lactone
 +
* inchi key:
 +
** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
 +
* molecular weight:
 +
** 178.141   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-galactonate-γ-lactone
 +
** galactono-γ-lactone
 +
** D-galactonolactone
 +
** D-galactono-γ-lactone
 +
** D-galactonic acid γ-lactone
 +
** γ-D-galactonolactone
 +
** D-(-)-galactonic acid γ-lactone
 +
** D-galactonic acid g-lactone
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''6''' reactions found over '''11''' reactions in the full pathway
+
* [[GALACTONOLACTONASE-RXN]]
* [[2.3.1.155-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[RXN-12507]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-14131]]
+
* [[RXN-14268]]
+
* [[RXN-14271]]
+
* [[RXN-16540]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14272 RXN-14272]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14273 RXN-14273]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16541 RXN-16541]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16542 RXN-16542]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16543 RXN-16543]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-7088}}
+
* CAS : 2782-07-2
{{#set: common name=(8E,10E)-dodeca-8,10-dienol biosynthesis}}
+
* PUBCHEM:
{{#set: reaction found=6}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165]
{{#set: reaction not found=11}}
+
* HMDB : HMDB02541
{{#set: completion rate=55.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.92162.html 92162]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895]
 +
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
 +
{{#set: common name=D-galactono-1,4-lactone}}
 +
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}}
 +
{{#set: molecular weight=178.141    }}
 +
{{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}}
 +
{{#set: consumed by=GALACTONOLACTONASE-RXN}}

Latest revision as of 19:35, 21 March 2018

Metabolite D-GALACTONO-1-4-LACTONE

  • smiles:
    • C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
  • common name:
    • D-galactono-1,4-lactone
  • inchi key:
    • InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
  • molecular weight:
    • 178.141
  • Synonym(s):
    • D-galactonate-γ-lactone
    • galactono-γ-lactone
    • D-galactonolactone
    • D-galactono-γ-lactone
    • D-galactonic acid γ-lactone
    • γ-D-galactonolactone
    • D-(-)-galactonic acid γ-lactone
    • D-galactonic acid g-lactone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.