Difference between revisions of "D-GALACTONO-1-4-LACTONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) |
* common name: | * common name: | ||
− | ** | + | ** D-galactono-1,4-lactone |
+ | * inchi key: | ||
+ | ** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N | ||
+ | * molecular weight: | ||
+ | ** 178.141 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** D-galactonate-γ-lactone | ||
+ | ** galactono-γ-lactone | ||
+ | ** D-galactonolactone | ||
+ | ** D-galactono-γ-lactone | ||
+ | ** D-galactonic acid γ-lactone | ||
+ | ** γ-D-galactonolactone | ||
+ | ** D-(-)-galactonic acid γ-lactone | ||
+ | ** D-galactonic acid g-lactone | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[GALACTONOLACTONASE-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2782-07-2 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165] |
− | {{#set: | + | * HMDB : HMDB02541 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.92162.html 92162] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895] | ||
+ | {{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}} | ||
+ | {{#set: common name=D-galactono-1,4-lactone}} | ||
+ | {{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}} | ||
+ | {{#set: molecular weight=178.141 }} | ||
+ | {{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}} | ||
+ | {{#set: consumed by=GALACTONOLACTONASE-RXN}} |
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite D-GALACTONO-1-4-LACTONE
- smiles:
- C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
- common name:
- D-galactono-1,4-lactone
- inchi key:
- InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
- molecular weight:
- 178.141
- Synonym(s):
- D-galactonate-γ-lactone
- galactono-γ-lactone
- D-galactonolactone
- D-galactono-γ-lactone
- D-galactonic acid γ-lactone
- γ-D-galactonolactone
- D-(-)-galactonic acid γ-lactone
- D-galactonic acid g-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.