Difference between revisions of "CPD-14424"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipoyl-Protein-N6-lipoyllysine Lipoyl-Protein-N6-lipoyllysine] == * common name: ** a [lipoyl-c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14424 CPD-14424] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14424 CPD-14424] == |
+ | * smiles: | ||
+ | ** CCC=CCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosapentaenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=KIDYDCLNVXONEF-PYBSMVOOSA-J | ||
+ | * molecular weight: | ||
+ | ** 1091.996 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosa-5,8,11,14,17-pentaenoyl-CoA |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13444]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-13443]] | |
− | + | ||
− | + | ||
− | * [[RXN- | + | |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551548 72551548] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76460 76460] | ||
+ | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosapentaenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=KIDYDCLNVXONEF-PYBSMVOOSA-J}} | ||
+ | {{#set: molecular weight=1091.996 }} | ||
+ | {{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosa-5,8,11,14,17-pentaenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-13444}} | ||
+ | {{#set: produced by=RXN-13443}} |
Latest revision as of 20:36, 21 March 2018
Contents
Metabolite CPD-14424
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosapentaenoyl-CoA
- inchi key:
- InChIKey=KIDYDCLNVXONEF-PYBSMVOOSA-J
- molecular weight:
- 1091.996
- Synonym(s):
- (5Z,8Z,11Z,14Z,17Z)-3R-hydroxy-docosa-5,8,11,14,17-pentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.