Difference between revisions of "COPROPORPHYRINOGEN I"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1275 PWY0-1275] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] == * smiles: ** CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5))) |
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** coproporphyrinogen I |
| + | * inchi key: | ||
| + | ** InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J | ||
| + | * molecular weight: | ||
| + | ** 656.734 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-10642]] | |
| − | == Reaction(s) | + | |
| − | * | + | |
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849147 20849147] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.20171594.html 20171594] |
| − | {{#set: | + | * HMDB : HMDB02158 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: reaction | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62631 62631] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05768 C05768] | ||
| + | {{#set: smiles=CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))}} | ||
| + | {{#set: common name=coproporphyrinogen I}} | ||
| + | {{#set: inchi key=InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J}} | ||
| + | {{#set: molecular weight=656.734 }} | ||
| + | {{#set: reversible reaction associated=RXN-10642}} | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite COPROPORPHYRINOGEN_I
- smiles:
- CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))
- common name:
- coproporphyrinogen I
- inchi key:
- InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J
- molecular weight:
- 656.734
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))" cannot be used as a page name in this wiki.
